C31H40N4O2 — CID 10163990
2-(1-benzylpiperidin-4-yl)-1'-(2-phenylethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3,4'-piperidine]-1,4-dione (PubChem CID 10163990) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-1'-(2-phenylethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3,4'-piperidine]-1,4-dione.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-1'-(2-phenylethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3,4'-piperidine]-1,4-dione |
|---|---|
| PubChem CID | 10163990 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-1'-(2-phenylethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3,4'-piperidine]-1,4-dione |
| SMILES | O=C1C2CCCN2C(=O)C2(CCN(CCc3ccccc3)CC2)N1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H40N4O2/c36-29-28-12-7-18-34(28)30(37)31(16-22-32(23-17-31)19-13-25-8-3-1-4-9-25)35(29)27-14-20-33(21-15-27)24-26-10-5-2-6-11-26/h1-6,8-11,27-28H,7,12-24H2 |
| InChIKey | XLTJOJAMKBBIAO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |