C19H17N3O6S — CID 10001885
(E)-3-ethoxy-3-hydroxy-2-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]prop-2-enenitrile (PubChem CID 10001885) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is (E)-3-ethoxy-3-hydroxy-2-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-3-ethoxy-3-hydroxy-2-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 10001885 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (E)-3-ethoxy-3-hydroxy-2-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-3H-1,2-benzothiazol-3-yl]prop-2-enenitrile |
| SMILES | CCO/C(O)=C(/C#N)C1c2ccccc2S(=O)(=O)N1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17N3O6S/c1-2-28-19(23)16(11-20)18-15-5-3-4-6-17(15)29(26,27)21(18)12-13-7-9-14(10-8-13)22(24)25/h3-10,18,23H,2,12H2,1H3/b19-16- |
| InChIKey | KXEJTTVFDAVILR-MNDPQUGUSA-N |
| XLogP | 3.17 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|