C16H14N2O2S — CID 25011177
2-[(3S)-2-benzyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetonitrile (PubChem CID 25011177) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-[(3S)-2-benzyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetonitrile.
| Compound Name | 2-[(3S)-2-benzyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetonitrile |
|---|---|
| PubChem CID | 25011177 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[(3S)-2-benzyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetonitrile |
| SMILES | N#CC[C@H]1c2ccccc2S(=O)(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H14N2O2S/c17-11-10-15-14-8-4-5-9-16(14)21(19,20)18(15)12-13-6-2-1-3-7-13/h1-9,15H,10,12H2/t15-/m0/s1 |
| InChIKey | TTWDFEYMSCSGFE-HNNXBMFYSA-N |
| XLogP | 2.85 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |