C27H26FNO2 — CID 1000366
ethyl (2R,3R,7S,13R,17S)-2-(4-fluorophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene-10-carboxylate (PubChem CID 1000366) has the molecular formula C27H26FNO2 and a molecular weight of 415.51 g/mol. Its IUPAC name is ethyl (2R,3R,7S,13R,17S)-2-(4-fluorophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene-10-carboxylate.
| Compound Name | ethyl (2R,3R,7S,13R,17S)-2-(4-fluorophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene-10-carboxylate |
|---|---|
| PubChem CID | 1000366 |
| Molecular Formula | C27H26FNO2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | ethyl (2R,3R,7S,13R,17S)-2-(4-fluorophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene-10-carboxylate |
| SMILES | CCOC(=O)c1cc2c3c(c1)[C@@H]1C=CC[C@@H]1CN3[C@@H](c1ccc(F)cc1)[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C27H26FNO2/c1-2-31-27(30)18-13-23-20-6-3-5-17(20)15-29-25(16-9-11-19(28)12-10-16)22-8-4-7-21(22)24(14-18)26(23)29/h3-4,6-7,9-14,17,20-22,25H,2,5,8,15H2,1H3/t17-,20-,21+,22-,25+/m1/s1 |
| InChIKey | AVJMLGPBLBABFW-FHBCLOHASA-N |
| XLogP | 5.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|