C26H26NO2- — CID 11889148
(2R,3S,7S,13S,18S)-2-phenyl-1-azapentacyclo[10.7.1.03,7.08,20.013,18]icosa-5,8,10,12(20)-tetraene-10-carboxylate (PubChem CID 11889148) has the molecular formula C26H26NO2- and a molecular weight of 384.50 g/mol. Its IUPAC name is (2R,3S,7S,13S,18S)-2-phenyl-1-azapentacyclo[10.7.1.03,7.08,20.013,18]icosa-5,8,10,12(20)-tetraene-10-carboxylate.
| Compound Name | (2R,3S,7S,13S,18S)-2-phenyl-1-azapentacyclo[10.7.1.03,7.08,20.013,18]icosa-5,8,10,12(20)-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 11889148 |
| Molecular Formula | C26H26NO2- |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (2R,3S,7S,13S,18S)-2-phenyl-1-azapentacyclo[10.7.1.03,7.08,20.013,18]icosa-5,8,10,12(20)-tetraene-10-carboxylate |
| SMILES | O=C([O-])c1cc2c3c(c1)[C@H]1CCCC[C@@H]1CN3[C@@H](c1ccccc1)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C26H27NO2/c28-26(29)18-13-22-19-10-5-4-9-17(19)15-27-24(16-7-2-1-3-8-16)21-12-6-11-20(21)23(14-18)25(22)27/h1-3,6-8,11,13-14,17,19-21,24H,4-5,9-10,12,15H2,(H,28,29)/p-1/t17-,19+,20+,21+,24+/m1/s1 |
| InChIKey | LGARIUWONWUFPT-JFLVIDOFSA-M |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|