C24H21BrN2O2 — CID 51422822
(2S,3S,7S,13S,17S)-10-bromo-2-(3-nitrophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene (PubChem CID 51422822) has the molecular formula C24H21BrN2O2 and a molecular weight of 449.35 g/mol. Its IUPAC name is (2S,3S,7S,13S,17S)-10-bromo-2-(3-nitrophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene.
| Compound Name | (2S,3S,7S,13S,17S)-10-bromo-2-(3-nitrophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene |
|---|---|
| PubChem CID | 51422822 |
| Molecular Formula | C24H21BrN2O2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (2S,3S,7S,13S,17S)-10-bromo-2-(3-nitrophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene |
| SMILES | O=[N+]([O-])c1cccc([C@@H]2[C@H]3CC=C[C@@H]3c3cc(Br)cc4c3N2C[C@H]2CC=C[C@H]42)c1 |
| InChI | InChI=1S/C24H21BrN2O2/c25-16-11-21-18-7-2-5-15(18)13-26-23(14-4-1-6-17(10-14)27(28)29)20-9-3-8-19(20)22(12-16)24(21)26/h1-4,6-8,10-12,15,18-20,23H,5,9,13H2/t15-,18+,19+,20+,23-/m1/s1 |
| InChIKey | YBSJBYCBSDKPCS-DJIOSBNXSA-N |
| XLogP | 6.25 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|