C25H24N2O2 — CID 11897814
(2R,3R,7R,13S,17S)-10-methyl-2-(3-nitrophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene (PubChem CID 11897814) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (2R,3R,7R,13S,17S)-10-methyl-2-(3-nitrophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene.
| Compound Name | (2R,3R,7R,13S,17S)-10-methyl-2-(3-nitrophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene |
|---|---|
| PubChem CID | 11897814 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2R,3R,7R,13S,17S)-10-methyl-2-(3-nitrophenyl)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene |
| SMILES | Cc1cc2c3c(c1)[C@@H]1C=CC[C@H]1[C@H](c1cccc([N+](=O)[O-])c1)N3C[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C25H24N2O2/c1-15-11-22-19-8-3-6-17(19)14-26-24(16-5-2-7-18(13-16)27(28)29)21-10-4-9-20(21)23(12-15)25(22)26/h2-5,7-9,11-13,17,19-21,24H,6,10,14H2,1H3/t17-,19+,20-,21-,24+/m1/s1 |
| InChIKey | VQOBDUXIBFXMEA-KFGLOJPWSA-N |
| XLogP | 5.80 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|