C27H30N2O4 — CID 129438966
(4R,10R,14S,15S)-15-(3-nitrophenyl)-4-pentyl-1-azatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8,11-tetraene-7-carboxylic acid (PubChem CID 129438966) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is (4R,10R,14S,15S)-15-(3-nitrophenyl)-4-pentyl-1-azatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8,11-tetraene-7-carboxylic acid.
| Compound Name | (4R,10R,14S,15S)-15-(3-nitrophenyl)-4-pentyl-1-azatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8,11-tetraene-7-carboxylic acid |
|---|---|
| PubChem CID | 129438966 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (4R,10R,14S,15S)-15-(3-nitrophenyl)-4-pentyl-1-azatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8,11-tetraene-7-carboxylic acid |
| SMILES | CCCCC[C@@H]1CCN2c3c1cc(C(=O)O)cc3[C@@H]1C=CC[C@@H]1[C@H]2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H30N2O4/c1-2-3-4-7-17-12-13-28-25(18-8-5-9-20(14-18)29(32)33)22-11-6-10-21(22)24-16-19(27(30)31)15-23(17)26(24)28/h5-6,8-10,14-17,21-22,25H,2-4,7,11-13H2,1H3,(H,30,31)/t17-,21-,22+,25-/m1/s1 |
| InChIKey | JPTYOWVXIFWSHO-SQTZCGGWSA-N |
| XLogP | 6.58 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|