C22H18N4O5S — CID 10003896
phenyl N-[4-[(4-carbamoyl-1H-benzimidazol-2-yl)methylsulfonyl]phenyl]carbamate (PubChem CID 10003896) has the molecular formula C22H18N4O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is phenyl N-[4-[(4-carbamoyl-1H-benzimidazol-2-yl)methylsulfonyl]phenyl]carbamate.
| Compound Name | phenyl N-[4-[(4-carbamoyl-1H-benzimidazol-2-yl)methylsulfonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 10003896 |
| Molecular Formula | C22H18N4O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | phenyl N-[4-[(4-carbamoyl-1H-benzimidazol-2-yl)methylsulfonyl]phenyl]carbamate |
| SMILES | NC(=O)c1cccc2[nH]c(CS(=O)(=O)c3ccc(NC(=O)Oc4ccccc4)cc3)nc12 |
| InChI | InChI=1S/C22H18N4O5S/c23-21(27)17-7-4-8-18-20(17)26-19(25-18)13-32(29,30)16-11-9-14(10-12-16)24-22(28)31-15-5-2-1-3-6-15/h1-12H,13H2,(H2,23,27)(H,24,28)(H,25,26) |
| InChIKey | OCDOJJKBROEEKR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |