C18H17N3O4S — CID 25109234
methyl 2-[(4-carbamoyl-1H-benzimidazol-2-yl)sulfanyl]-2-(4-methoxyphenyl)acetate (PubChem CID 25109234) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is methyl 2-[(4-carbamoyl-1H-benzimidazol-2-yl)sulfanyl]-2-(4-methoxyphenyl)acetate.
| Compound Name | methyl 2-[(4-carbamoyl-1H-benzimidazol-2-yl)sulfanyl]-2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 25109234 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | methyl 2-[(4-carbamoyl-1H-benzimidazol-2-yl)sulfanyl]-2-(4-methoxyphenyl)acetate |
| SMILES | COC(=O)C(Sc1nc2c(C(N)=O)cccc2[nH]1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-24-11-8-6-10(7-9-11)15(17(23)25-2)26-18-20-13-5-3-4-12(16(19)22)14(13)21-18/h3-9,15H,1-2H3,(H2,19,22)(H,20,21) |
| InChIKey | NLRJPTWPXHSARW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |