C26H33N3O4 — CID 10003965
[4-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ylmethoxy)phenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 10003965) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is [4-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ylmethoxy)phenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ylmethoxy)phenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 10003965 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | [4-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ylmethoxy)phenyl]-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(OCC2CCC3CCCCN3C2)cc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C26H33N3O4/c30-25(27-13-15-28(16-14-27)26(31)24-5-3-17-32-24)21-7-10-23(11-8-21)33-19-20-6-9-22-4-1-2-12-29(22)18-20/h3,5,7-8,10-11,17,20,22H,1-2,4,6,9,12-16,18-19H2 |
| InChIKey | MEAPKTHPUKANBN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |