C20H24FN7O3S — CID 10004485
N-[[(5S)-3-[3-fluoro-4-[4-(5-methyl-1H-1,2,4-triazole-3-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10004485) has the molecular formula C20H24FN7O3S and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(5-methyl-1H-1,2,4-triazole-3-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(5-methyl-1H-1,2,4-triazole-3-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10004485 |
| Molecular Formula | C20H24FN7O3S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(5-methyl-1H-1,2,4-triazole-3-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=S)c4n[nH]c(C)n4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H24FN7O3S/c1-12-23-18(25-24-12)19(32)27-7-5-26(6-8-27)17-4-3-14(9-16(17)21)28-11-15(31-20(28)30)10-22-13(2)29/h3-4,9,15H,5-8,10-11H2,1-2H3,(H,22,29)(H,23,24,25)/t15-/m0/s1 |
| InChIKey | IQBJETZNYSNRRN-HNNXBMFYSA-N |
| XLogP | 1.21 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|