C21H29FN6O3S — CID 10050110
N-[[(5S)-3-[3-fluoro-4-[4-(piperazine-2-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10050110) has the molecular formula C21H29FN6O3S and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(piperazine-2-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(piperazine-2-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10050110 |
| Molecular Formula | C21H29FN6O3S |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(piperazine-2-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=S)C4CNCCN4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H29FN6O3S/c1-14(29)25-11-16-13-28(21(30)31-16)15-2-3-19(17(22)10-15)26-6-8-27(9-7-26)20(32)18-12-23-4-5-24-18/h2-3,10,16,18,23-24H,4-9,11-13H2,1H3,(H,25,29)/t16-,18?/m0/s1 |
| InChIKey | ZZVHJMFUDYXOJO-ATNAJCNCSA-N |
| XLogP | 0.30 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|