C24H34O10 — CID 10005460
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 10005460) has the molecular formula C24H34O10 and a molecular weight of 482.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10005460 |
| Molecular Formula | C24H34O10 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | C=C(C)[C@@H]1CC=C(CO[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)CC1 |
| InChI | InChI=1S/C24H34O10/c1-13(2)19-9-7-18(8-10-19)11-30-24-23(33-17(6)28)22(32-16(5)27)21(31-15(4)26)20(34-24)12-29-14(3)25/h7,19-24H,1,8-12H2,2-6H3/t19-,20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | OIIPBFKVMKTNEZ-YWIRWFRESA-N |
| XLogP | 2.39 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|