C31H34N2O3 — CID 10005478
N-[3-(4-butanoyl-4-phenylpiperidin-1-yl)-3-oxopropyl]-4-phenylbenzamide (PubChem CID 10005478) has the molecular formula C31H34N2O3 and a molecular weight of 482.62 g/mol. Its IUPAC name is N-[3-(4-butanoyl-4-phenylpiperidin-1-yl)-3-oxopropyl]-4-phenylbenzamide.
| Compound Name | N-[3-(4-butanoyl-4-phenylpiperidin-1-yl)-3-oxopropyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 10005478 |
| Molecular Formula | C31H34N2O3 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-[3-(4-butanoyl-4-phenylpiperidin-1-yl)-3-oxopropyl]-4-phenylbenzamide |
| SMILES | CCCC(=O)C1(c2ccccc2)CCN(C(=O)CCNC(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C31H34N2O3/c1-2-9-28(34)31(27-12-7-4-8-13-27)19-22-33(23-20-31)29(35)18-21-32-30(36)26-16-14-25(15-17-26)24-10-5-3-6-11-24/h3-8,10-17H,2,9,18-23H2,1H3,(H,32,36) |
| InChIKey | VOTGZWYUTIDMCC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |