C26H32N2O3 — CID 10432288
N-[2-(4-acetyl-4-phenylpiperidin-1-yl)-2-oxoethyl]-4-(2-methylpropyl)benzamide (PubChem CID 10432288) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-[2-(4-acetyl-4-phenylpiperidin-1-yl)-2-oxoethyl]-4-(2-methylpropyl)benzamide.
| Compound Name | N-[2-(4-acetyl-4-phenylpiperidin-1-yl)-2-oxoethyl]-4-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 10432288 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-[2-(4-acetyl-4-phenylpiperidin-1-yl)-2-oxoethyl]-4-(2-methylpropyl)benzamide |
| SMILES | CC(=O)C1(c2ccccc2)CCN(C(=O)CNC(=O)c2ccc(CC(C)C)cc2)CC1 |
| InChI | InChI=1S/C26H32N2O3/c1-19(2)17-21-9-11-22(12-10-21)25(31)27-18-24(30)28-15-13-26(14-16-28,20(3)29)23-7-5-4-6-8-23/h4-12,19H,13-18H2,1-3H3,(H,27,31) |
| InChIKey | QNVDHCSULRCWDH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |