C32H50O3 — CID 10005489
[(3S,4aR,6aS,6bS,8aR,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-6-oxo-2,3,4a,5,7,8,9,10,12,12a,13,14-dodecahydro-1H-picen-3-yl] acetate (PubChem CID 10005489) has the molecular formula C32H50O3 and a molecular weight of 482.75 g/mol. Its IUPAC name is [(3S,4aR,6aS,6bS,8aR,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-6-oxo-2,3,4a,5,7,8,9,10,12,12a,13,14-dodecahydro-1H-picen-3-yl] acetate.
| Compound Name | [(3S,4aR,6aS,6bS,8aR,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-6-oxo-2,3,4a,5,7,8,9,10,12,12a,13,14-dodecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 10005489 |
| Molecular Formula | C32H50O3 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | [(3S,4aR,6aS,6bS,8aR,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-6-oxo-2,3,4a,5,7,8,9,10,12,12a,13,14-dodecahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C3=C(C(=O)C[C@H]2C1(C)C)[C@@]1(C)CC[C@@]2(C)CCC(C)(C)C[C@H]2[C@]1(C)CC3 |
| InChI | InChI=1S/C32H50O3/c1-20(33)35-25-11-12-30(7)21-10-13-31(8)24-19-27(2,3)14-15-29(24,6)16-17-32(31,9)26(21)22(34)18-23(30)28(25,4)5/h23-25H,10-19H2,1-9H3/t23-,24+,25-,29+,30+,31-,32+/m0/s1 |
| InChIKey | YMYAJTUVCWTRPQ-KEUKQDRTSA-N |
| XLogP | 8.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |