C32H48O4 — CID 72794172
(4,4,6a,6b,8a,11,11,14b-octamethyl-12,13-dioxo-1,2,3,4a,5,6,7,8,9,10,14,14a-dodecahydropicen-3-yl) acetate (PubChem CID 72794172) has the molecular formula C32H48O4 and a molecular weight of 496.73 g/mol. Its IUPAC name is (4,4,6a,6b,8a,11,11,14b-octamethyl-12,13-dioxo-1,2,3,4a,5,6,7,8,9,10,14,14a-dodecahydropicen-3-yl) acetate.
| Compound Name | (4,4,6a,6b,8a,11,11,14b-octamethyl-12,13-dioxo-1,2,3,4a,5,6,7,8,9,10,14,14a-dodecahydropicen-3-yl) acetate |
|---|---|
| PubChem CID | 72794172 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | (4,4,6a,6b,8a,11,11,14b-octamethyl-12,13-dioxo-1,2,3,4a,5,6,7,8,9,10,14,14a-dodecahydropicen-3-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC(=O)C2=C4C(=O)C(C)(C)CCC4(C)CCC23C)C1(C)C |
| InChI | InChI=1S/C32H48O4/c1-19(33)36-23-11-12-30(7)21(28(23,4)5)10-13-31(8)22(30)18-20(34)24-25-26(35)27(2,3)14-15-29(25,6)16-17-32(24,31)9/h21-23H,10-18H2,1-9H3 |
| InChIKey | UBRSSGIFIWILOJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |