C33H48O4 — CID 71677495
[(3S,4aR,6aR,6bS,8aS,11S,14aR,14bS)-11-acetyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,14a-decahydro-1H-picen-3-yl] acetate (PubChem CID 71677495) has the molecular formula C33H48O4 and a molecular weight of 508.74 g/mol. Its IUPAC name is [(3S,4aR,6aR,6bS,8aS,11S,14aR,14bS)-11-acetyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,14a-decahydro-1H-picen-3-yl] acetate.
| Compound Name | [(3S,4aR,6aR,6bS,8aS,11S,14aR,14bS)-11-acetyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,14a-decahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 71677495 |
| Molecular Formula | C33H48O4 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | [(3S,4aR,6aR,6bS,8aS,11S,14aR,14bS)-11-acetyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,14a-decahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3C(=O)C=C4C5=C[C@@](C)(C(C)=O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C33H48O4/c1-20(34)30(6)15-14-29(5)16-17-32(8)22(23(29)19-30)18-24(36)27-31(7)12-11-26(37-21(2)35)28(3,4)25(31)10-13-33(27,32)9/h18-19,25-27H,10-17H2,1-9H3/t25-,26-,27+,29+,30-,31-,32+,33+/m0/s1 |
| InChIKey | GQRQZNMQLIJPFY-ICIHAQMGSA-N |
| XLogP | 7.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |