C40H58O5 — CID 102314149
[(2R,4aS,6aS,7R,8aR,10R,12aS,14aS,14bR)-10-acetyloxy-7-methoxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,3,4,5,6,7,8,8a,10,11,12,13,14,14b-tetradecahydropicen-2-yl]methyl benzoate (PubChem CID 102314149) has the molecular formula C40H58O5 and a molecular weight of 618.90 g/mol. Its IUPAC name is [(2R,4aS,6aS,7R,8aR,10R,12aS,14aS,14bR)-10-acetyloxy-7-methoxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,3,4,5,6,7,8,8a,10,11,12,13,14,14b-tetradecahydropicen-2-yl]methyl benzoate.
| Compound Name | [(2R,4aS,6aS,7R,8aR,10R,12aS,14aS,14bR)-10-acetyloxy-7-methoxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,3,4,5,6,7,8,8a,10,11,12,13,14,14b-tetradecahydropicen-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102314149 |
| Molecular Formula | C40H58O5 |
| Molecular Weight | 618.90 g/mol |
| Exact Mass | 618.43 |
| IUPAC Name | [(2R,4aS,6aS,7R,8aR,10R,12aS,14aS,14bR)-10-acetyloxy-7-methoxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,3,4,5,6,7,8,8a,10,11,12,13,14,14b-tetradecahydropicen-2-yl]methyl benzoate |
| SMILES | CO[C@@H]1C[C@H]2C(C)(C)[C@H](OC(C)=O)CC[C@]2(C)C2=C1[C@@]1(C)CC[C@@]3(C)CC[C@@](C)(COC(=O)c4ccccc4)C[C@H]3[C@]1(C)CC2 |
| InChI | InChI=1S/C40H58O5/c1-26(41)45-32-16-17-38(6)28-15-18-39(7)31-24-36(4,25-44-34(42)27-13-11-10-12-14-27)19-20-37(31,5)21-22-40(39,8)33(28)29(43-9)23-30(38)35(32,2)3/h10-14,29-32H,15-25H2,1-9H3/t29-,30+,31-,32-,36-,37-,38-,39+,40-/m1/s1 |
| InChIKey | JLZFXYCCPAMDOX-WARQHHFGSA-N |
| XLogP | 9.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.90 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|