C26H48O6Si2 — CID 10006639
methyl (6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-6-(2-methyloxiran-2-yl)non-8-enoate (PubChem CID 10006639) has the molecular formula C26H48O6Si2 and a molecular weight of 512.84 g/mol. Its IUPAC name is methyl (6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-6-(2-methyloxiran-2-yl)non-8-enoate.
| Compound Name | methyl (6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-6-(2-methyloxiran-2-yl)non-8-enoate |
|---|---|
| PubChem CID | 10006639 |
| Molecular Formula | C26H48O6Si2 |
| Molecular Weight | 512.84 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | methyl (6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-6-(2-methyloxiran-2-yl)non-8-enoate |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC(=C=C(OCC)O[Si](C)(C)C)CCC(=O)OC)C1(C)CO1 |
| InChI | InChI=1S/C26H48O6Si2/c1-13-22(31-34(11,12)25(3,4)5)21(26(6)19-30-26)17-20(15-16-23(27)28-7)18-24(29-14-2)32-33(8,9)10/h13,21-22H,1,14-17,19H2,2-12H3/t18?,21-,22-,26?/m0/s1 |
| InChIKey | MHOCPHRIZXWKJX-RUXLQCTDSA-N |
| XLogP | 6.57 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.84 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|