C22H44O5Si2 — CID 11797570
ethyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2R)-3,3-dimethyl-2-(trimethylsilyloxymethyl)oxiran-2-yl]-3-methylidenepentanoate (PubChem CID 11797570) has the molecular formula C22H44O5Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is ethyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2R)-3,3-dimethyl-2-(trimethylsilyloxymethyl)oxiran-2-yl]-3-methylidenepentanoate.
| Compound Name | ethyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2R)-3,3-dimethyl-2-(trimethylsilyloxymethyl)oxiran-2-yl]-3-methylidenepentanoate |
|---|---|
| PubChem CID | 11797570 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | ethyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2R)-3,3-dimethyl-2-(trimethylsilyloxymethyl)oxiran-2-yl]-3-methylidenepentanoate |
| SMILES | C=C(CC(=O)OCC)[C@H](C[C@]1(CO[Si](C)(C)C)OC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O5Si2/c1-13-24-19(23)14-17(2)18(26-29(11,12)20(3,4)5)15-22(21(6,7)27-22)16-25-28(8,9)10/h18H,2,13-16H2,1,3-12H3/t18-,22+/m0/s1 |
| InChIKey | KSGPWDBDGXWICW-PGRDOPGGSA-N |
| XLogP | 5.68 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|