C30H54O6Si — CID 72700972
(1R,3R,5R,6R,10R,13S,18S,19S)-5-[diethoxy(methyl)silyl]-6,13,19-trimethyl-8-methylidene-10-propyl-4,11,21-trioxatricyclo[16.2.1.03,5]henicosan-12-one (PubChem CID 72700972) has the molecular formula C30H54O6Si and a molecular weight of 538.84 g/mol. Its IUPAC name is (1R,3R,5R,6R,10R,13S,18S,19S)-5-[diethoxy(methyl)silyl]-6,13,19-trimethyl-8-methylidene-10-propyl-4,11,21-trioxatricyclo[16.2.1.03,5]henicosan-12-one.
| Compound Name | (1R,3R,5R,6R,10R,13S,18S,19S)-5-[diethoxy(methyl)silyl]-6,13,19-trimethyl-8-methylidene-10-propyl-4,11,21-trioxatricyclo[16.2.1.03,5]henicosan-12-one |
|---|---|
| PubChem CID | 72700972 |
| Molecular Formula | C30H54O6Si |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | (1R,3R,5R,6R,10R,13S,18S,19S)-5-[diethoxy(methyl)silyl]-6,13,19-trimethyl-8-methylidene-10-propyl-4,11,21-trioxatricyclo[16.2.1.03,5]henicosan-12-one |
| SMILES | C=C1C[C@@H](CCC)OC(=O)[C@@H](C)CCCC[C@@H]2O[C@H](C[C@@H]2C)C[C@H]2O[C@@]2([Si](C)(OCC)OCC)[C@H](C)C1 |
| InChI | InChI=1S/C30H54O6Si/c1-9-14-25-18-21(4)17-24(7)30(37(8,32-10-2)33-11-3)28(36-30)20-26-19-23(6)27(34-26)16-13-12-15-22(5)29(31)35-25/h22-28H,4,9-20H2,1-3,5-8H3/t22-,23-,24+,25+,26+,27-,28+,30+/m0/s1 |
| InChIKey | DCFATQLEQSJFMZ-WOJXUFOLSA-N |
| XLogP | 6.89 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|