C23H40O6Si — CID 10252708
methyl 4-[[(4R,5S)-5-ethenyl-2,2,6,6-tetramethyl-1,3-dioxan-4-yl]methyl]-6-ethoxy-6-trimethylsilyloxyhexa-4,5-dienoate (PubChem CID 10252708) has the molecular formula C23H40O6Si and a molecular weight of 440.65 g/mol. Its IUPAC name is methyl 4-[[(4R,5S)-5-ethenyl-2,2,6,6-tetramethyl-1,3-dioxan-4-yl]methyl]-6-ethoxy-6-trimethylsilyloxyhexa-4,5-dienoate.
| Compound Name | methyl 4-[[(4R,5S)-5-ethenyl-2,2,6,6-tetramethyl-1,3-dioxan-4-yl]methyl]-6-ethoxy-6-trimethylsilyloxyhexa-4,5-dienoate |
|---|---|
| PubChem CID | 10252708 |
| Molecular Formula | C23H40O6Si |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | methyl 4-[[(4R,5S)-5-ethenyl-2,2,6,6-tetramethyl-1,3-dioxan-4-yl]methyl]-6-ethoxy-6-trimethylsilyloxyhexa-4,5-dienoate |
| SMILES | C=C[C@H]1[C@@H](CC(=C=C(OCC)O[Si](C)(C)C)CCC(=O)OC)OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C23H40O6Si/c1-11-18-19(27-23(5,6)29-22(18,3)4)15-17(13-14-20(24)25-7)16-21(26-12-2)28-30(8,9)10/h11,18-19H,1,12-15H2,2-10H3/t16?,18-,19+/m0/s1 |
| InChIKey | AWGKDNUEYARBOY-NGFYBIIMSA-N |
| XLogP | 5.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|