C30H33F2N7 — CID 10007160
2-[4-[2,2-bis(4-fluorophenyl)ethylamino]piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine (PubChem CID 10007160) has the molecular formula C30H33F2N7 and a molecular weight of 529.64 g/mol. Its IUPAC name is 2-[4-[2,2-bis(4-fluorophenyl)ethylamino]piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine.
| Compound Name | 2-[4-[2,2-bis(4-fluorophenyl)ethylamino]piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine |
|---|---|
| PubChem CID | 10007160 |
| Molecular Formula | C30H33F2N7 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 2-[4-[2,2-bis(4-fluorophenyl)ethylamino]piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine |
| SMILES | C=CCNc1nc(N2CCC(NCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)nc2c1ncn2CC=C |
| InChI | InChI=1S/C30H33F2N7/c1-3-15-33-28-27-29(39(16-4-2)20-35-27)37-30(36-28)38-17-13-25(14-18-38)34-19-26(21-5-9-23(31)10-6-21)22-7-11-24(32)12-8-22/h3-12,20,25-26,34H,1-2,13-19H2,(H,33,36,37) |
| InChIKey | ATAAXLOHXYSKEX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|