C28H26Cl2FNO5 — CID 10007605
[[3-chloro-4-(4-chloro-2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamoyl]oxymethyl 3-methylbutanoate (PubChem CID 10007605) has the molecular formula C28H26Cl2FNO5 and a molecular weight of 546.42 g/mol. Its IUPAC name is [[3-chloro-4-(4-chloro-2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamoyl]oxymethyl 3-methylbutanoate.
| Compound Name | [[3-chloro-4-(4-chloro-2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamoyl]oxymethyl 3-methylbutanoate |
|---|---|
| PubChem CID | 10007605 |
| Molecular Formula | C28H26Cl2FNO5 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | [[3-chloro-4-(4-chloro-2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamoyl]oxymethyl 3-methylbutanoate |
| SMILES | Cc1cc(Cl)ccc1C(=O)c1ccc(N(C(=O)OCOC(=O)CC(C)C)c2ccc(F)cc2C)cc1Cl |
| InChI | InChI=1S/C28H26Cl2FNO5/c1-16(2)11-26(33)36-15-37-28(35)32(25-10-6-20(31)13-18(25)4)21-7-9-23(24(30)14-21)27(34)22-8-5-19(29)12-17(22)3/h5-10,12-14,16H,11,15H2,1-4H3 |
| InChIKey | JVPZXLOWRULUSS-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|