C28H25ClFNO5 — CID 10255750
[[3-chloro-4-(2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamoyl]oxymethyl (E)-pent-3-enoate (PubChem CID 10255750) has the molecular formula C28H25ClFNO5 and a molecular weight of 509.96 g/mol. Its IUPAC name is [[3-chloro-4-(2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamoyl]oxymethyl (E)-pent-3-enoate.
| Compound Name | [[3-chloro-4-(2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamoyl]oxymethyl (E)-pent-3-enoate |
|---|---|
| PubChem CID | 10255750 |
| Molecular Formula | C28H25ClFNO5 |
| Molecular Weight | 509.96 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | [[3-chloro-4-(2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamoyl]oxymethyl (E)-pent-3-enoate |
| SMILES | C/C=C/CC(=O)OCOC(=O)N(c1ccc(C(=O)c2ccccc2C)c(Cl)c1)c1ccc(F)cc1C |
| InChI | InChI=1S/C28H25ClFNO5/c1-4-5-10-26(32)35-17-36-28(34)31(25-14-11-20(30)15-19(25)3)21-12-13-23(24(29)16-21)27(33)22-9-7-6-8-18(22)2/h4-9,11-16H,10,17H2,1-3H3/b5-4+ |
| InChIKey | WHWZHEWHOGCFRK-SNAWJCMRSA-N |
| XLogP | 7.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.96 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|