C22H16Cl2FNO3 — CID 91484056
[3-chloro-4-(4-chloro-2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamic acid (PubChem CID 91484056) has the molecular formula C22H16Cl2FNO3 and a molecular weight of 432.28 g/mol. Its IUPAC name is [3-chloro-4-(4-chloro-2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamic acid.
| Compound Name | [3-chloro-4-(4-chloro-2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamic acid |
|---|---|
| PubChem CID | 91484056 |
| Molecular Formula | C22H16Cl2FNO3 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | [3-chloro-4-(4-chloro-2-methylbenzoyl)phenyl]-(4-fluoro-2-methylphenyl)carbamic acid |
| SMILES | Cc1cc(Cl)ccc1C(=O)c1ccc(N(C(=O)O)c2ccc(F)cc2C)cc1Cl |
| InChI | InChI=1S/C22H16Cl2FNO3/c1-12-9-14(23)3-6-17(12)21(27)18-7-5-16(11-19(18)24)26(22(28)29)20-8-4-15(25)10-13(20)2/h3-11H,1-2H3,(H,28,29) |
| InChIKey | JWYQXRGBFQPXTO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |