C27H23BrClNO7 — CID 11758104
4-[[(4-bromo-2-methylphenyl)-[3-chloro-4-(2-methylbenzoyl)phenyl]carbamoyl]oxymethoxy]-4-oxobutanoic acid (PubChem CID 11758104) has the molecular formula C27H23BrClNO7 and a molecular weight of 588.84 g/mol. Its IUPAC name is 4-[[(4-bromo-2-methylphenyl)-[3-chloro-4-(2-methylbenzoyl)phenyl]carbamoyl]oxymethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(4-bromo-2-methylphenyl)-[3-chloro-4-(2-methylbenzoyl)phenyl]carbamoyl]oxymethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11758104 |
| Molecular Formula | C27H23BrClNO7 |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 587.03 |
| IUPAC Name | 4-[[(4-bromo-2-methylphenyl)-[3-chloro-4-(2-methylbenzoyl)phenyl]carbamoyl]oxymethoxy]-4-oxobutanoic acid |
| SMILES | Cc1ccccc1C(=O)c1ccc(N(C(=O)OCOC(=O)CCC(=O)O)c2ccc(Br)cc2C)cc1Cl |
| InChI | InChI=1S/C27H23BrClNO7/c1-16-5-3-4-6-20(16)26(34)21-9-8-19(14-22(21)29)30(23-10-7-18(28)13-17(23)2)27(35)37-15-36-25(33)12-11-24(31)32/h3-10,13-14H,11-12,15H2,1-2H3,(H,31,32) |
| InChIKey | KWXFRKSZAROGDT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|