C32H44N4O4 — CID 10007683
2,5-bis[3-[ethyl-[(2-methoxyphenyl)methyl]amino]propylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10007683) has the molecular formula C32H44N4O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is 2,5-bis[3-[ethyl-[(2-methoxyphenyl)methyl]amino]propylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[3-[ethyl-[(2-methoxyphenyl)methyl]amino]propylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10007683 |
| Molecular Formula | C32H44N4O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 2,5-bis[3-[ethyl-[(2-methoxyphenyl)methyl]amino]propylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCCNC1=CC(=O)C(NCCCN(CC)Cc2ccccc2OC)=CC1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C32H44N4O4/c1-5-35(23-25-13-7-9-15-31(25)39-3)19-11-17-33-27-21-30(38)28(22-29(27)37)34-18-12-20-36(6-2)24-26-14-8-10-16-32(26)40-4/h7-10,13-16,21-22,33-34H,5-6,11-12,17-20,23-24H2,1-4H3 |
| InChIKey | GWPNFCVXNGPDFU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|