C22H21F7N2O5S — CID 10007916
N-hydroxy-4-[4-[5-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10007916) has the molecular formula C22H21F7N2O5S and a molecular weight of 558.47 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10007916 |
| Molecular Formula | C22H21F7N2O5S |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | N-hydroxy-4-[4-[5-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(C(F)(F)F)C(F)(F)F)cn3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H21F7N2O5S/c23-20(21(24,25)26,22(27,28)29)8-7-14-1-6-17(30-13-14)15-2-4-16(5-3-15)37(34,35)19(18(32)31-33)9-11-36-12-10-19/h1-6,13,33H,7-12H2,(H,31,32) |
| InChIKey | WFOREQWTQKRTEQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|