C24H30F3N3O6S — CID 10007588
N-hydroxy-4-(2-methoxyethoxy)-1-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]phenyl]sulfonylcyclohexane-1-carboxamide (PubChem CID 10007588) has the molecular formula C24H30F3N3O6S and a molecular weight of 545.58 g/mol. Its IUPAC name is N-hydroxy-4-(2-methoxyethoxy)-1-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]phenyl]sulfonylcyclohexane-1-carboxamide.
| Compound Name | N-hydroxy-4-(2-methoxyethoxy)-1-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]phenyl]sulfonylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10007588 |
| Molecular Formula | C24H30F3N3O6S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | N-hydroxy-4-(2-methoxyethoxy)-1-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]phenyl]sulfonylcyclohexane-1-carboxamide |
| SMILES | COCCOC1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3cnc(CCCC(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C24H30F3N3O6S/c1-35-13-14-36-19-8-11-23(12-9-19,22(31)30-32)37(33,34)20-6-4-17(5-7-20)21-16-28-18(15-29-21)3-2-10-24(25,26)27/h4-7,15-16,19,32H,2-3,8-14H2,1H3,(H,30,31) |
| InChIKey | LUMVBIVFABHPCV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|