C22H24F5N3O5S — CID 10075880
N-hydroxy-4-methoxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylcyclohexane-1-carboxamide (PubChem CID 10075880) has the molecular formula C22H24F5N3O5S and a molecular weight of 537.51 g/mol. Its IUPAC name is N-hydroxy-4-methoxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylcyclohexane-1-carboxamide.
| Compound Name | N-hydroxy-4-methoxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10075880 |
| Molecular Formula | C22H24F5N3O5S |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | N-hydroxy-4-methoxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylcyclohexane-1-carboxamide |
| SMILES | COC1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C22H24F5N3O5S/c1-35-16-7-9-20(10-8-16,19(31)30-32)36(33,34)17-4-2-14(3-5-17)18-13-28-15(12-29-18)6-11-21(23,24)22(25,26)27/h2-5,12-13,16,32H,6-11H2,1H3,(H,30,31) |
| InChIKey | DQOIZPIBBVVWIY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|