C23H25F5N4O4S — CID 10370267
1-cyclopropyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 10370267) has the molecular formula C23H25F5N4O4S and a molecular weight of 548.53 g/mol. Its IUPAC name is 1-cyclopropyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10370267 |
| Molecular Formula | C23H25F5N4O4S |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1-cyclopropyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C23H25F5N4O4S/c24-22(25,23(26,27)28)8-7-16-13-30-19(14-29-16)15-1-5-18(6-2-15)37(35,36)21(20(33)31-34)9-11-32(12-10-21)17-3-4-17/h1-2,5-6,13-14,17,34H,3-4,7-12H2,(H,31,33) |
| InChIKey | LOPNDFUAPBMYTB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|