C20H19F5N4O6S — CID 10324941
5-[4-[4-(hydroxycarbamoyl)oxan-4-yl]sulfonylphenyl]-N-(2,2,3,3,3-pentafluoropropyl)pyrazine-2-carboxamide (PubChem CID 10324941) has the molecular formula C20H19F5N4O6S and a molecular weight of 538.45 g/mol. Its IUPAC name is 5-[4-[4-(hydroxycarbamoyl)oxan-4-yl]sulfonylphenyl]-N-(2,2,3,3,3-pentafluoropropyl)pyrazine-2-carboxamide.
| Compound Name | 5-[4-[4-(hydroxycarbamoyl)oxan-4-yl]sulfonylphenyl]-N-(2,2,3,3,3-pentafluoropropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10324941 |
| Molecular Formula | C20H19F5N4O6S |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 5-[4-[4-(hydroxycarbamoyl)oxan-4-yl]sulfonylphenyl]-N-(2,2,3,3,3-pentafluoropropyl)pyrazine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)(F)F)c1cnc(-c2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C20H19F5N4O6S/c21-19(22,20(23,24)25)11-28-16(30)15-10-26-14(9-27-15)12-1-3-13(4-2-12)36(33,34)18(17(31)29-32)5-7-35-8-6-18/h1-4,9-10,32H,5-8,11H2,(H,28,30)(H,29,31) |
| InChIKey | JIDXGXLSYLXFNS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 147.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|