C22H25F5N4O4S — CID 10414809
1-ethyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 10414809) has the molecular formula C22H25F5N4O4S and a molecular weight of 536.52 g/mol. Its IUPAC name is 1-ethyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-ethyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10414809 |
| Molecular Formula | C22H25F5N4O4S |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 1-ethyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C22H25F5N4O4S/c1-2-31-11-9-20(10-12-31,19(32)30-33)36(34,35)17-5-3-15(4-6-17)18-14-28-16(13-29-18)7-8-21(23,24)22(25,26)27/h3-6,13-14,33H,2,7-12H2,1H3,(H,30,32) |
| InChIKey | YDQLRVRQPAFQFY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|