C26H26FN3O4S — CID 10255233
1-cyclopropyl-4-[4-[5-(2-fluorophenyl)-2-pyridinyl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide (PubChem CID 10255233) has the molecular formula C26H26FN3O4S and a molecular weight of 495.58 g/mol. Its IUPAC name is 1-cyclopropyl-4-[4-[5-(2-fluorophenyl)-2-pyridinyl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-4-[4-[5-(2-fluorophenyl)-2-pyridinyl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10255233 |
| Molecular Formula | C26H26FN3O4S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 1-cyclopropyl-4-[4-[5-(2-fluorophenyl)-2-pyridinyl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(-c4ccccc4F)cn3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C26H26FN3O4S/c27-23-4-2-1-3-22(23)19-7-12-24(28-17-19)18-5-10-21(11-6-18)35(33,34)26(25(31)29-32)13-15-30(16-14-26)20-8-9-20/h1-7,10-12,17,20,32H,8-9,13-16H2,(H,29,31) |
| InChIKey | VYNNAEWUOBPWQF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|