C20H22F3N3O5S — CID 10390098
N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10390098) has the molecular formula C20H22F3N3O5S and a molecular weight of 473.47 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10390098 |
| Molecular Formula | C20H22F3N3O5S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3cnc(CCCC(F)(F)F)cn3)cc2)CCOCC1 |
| InChI | InChI=1S/C20H22F3N3O5S/c21-20(22,23)7-1-2-15-12-25-17(13-24-15)14-3-5-16(6-4-14)32(29,30)19(18(27)26-28)8-10-31-11-9-19/h3-6,12-13,28H,1-2,7-11H2,(H,26,27) |
| InChIKey | NBVXEZHPOMICNU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|