C25H31F3N2O6S — CID 10256856
N-hydroxy-4-(2-methoxyethoxy)-1-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylcyclohexane-1-carboxamide (PubChem CID 10256856) has the molecular formula C25H31F3N2O6S and a molecular weight of 544.59 g/mol. Its IUPAC name is N-hydroxy-4-(2-methoxyethoxy)-1-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylcyclohexane-1-carboxamide.
| Compound Name | N-hydroxy-4-(2-methoxyethoxy)-1-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10256856 |
| Molecular Formula | C25H31F3N2O6S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | N-hydroxy-4-(2-methoxyethoxy)-1-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylcyclohexane-1-carboxamide |
| SMILES | COCCOC1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C25H31F3N2O6S/c1-35-15-16-36-20-10-13-24(14-11-20,23(31)30-32)37(33,34)21-7-5-19(6-8-21)22-9-4-18(17-29-22)3-2-12-25(26,27)28/h4-9,17,20,32H,2-3,10-16H2,1H3,(H,30,31) |
| InChIKey | DFOOAIUHQDTAFM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|