C20H23F2N3O5S — CID 11540462
4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 11540462) has the molecular formula C20H23F2N3O5S and a molecular weight of 455.48 g/mol. Its IUPAC name is 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 11540462 |
| Molecular Formula | C20H23F2N3O5S |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CC(F)(F)CCc1cnc(-c2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C20H23F2N3O5S/c1-19(21,22)7-6-15-12-24-17(13-23-15)14-2-4-16(5-3-14)31(28,29)20(18(26)25-27)8-10-30-11-9-20/h2-5,12-13,27H,6-11H2,1H3,(H,25,26) |
| InChIKey | NZEIXOZFMZLALU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|