C16H17Cl3N2O10S2 — CID 10008139
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-dithiazolidin-4-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 10008139) has the molecular formula C16H17Cl3N2O10S2 and a molecular weight of 567.81 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-dithiazolidin-4-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-dithiazolidin-4-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10008139 |
| Molecular Formula | C16H17Cl3N2O10S2 |
| Molecular Weight | 567.81 g/mol |
| Exact Mass | 565.94 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-dithiazolidin-4-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1n1c(=O)ssc1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H17Cl3N2O10S2/c1-5(22)27-4-8-10(28-6(2)23)11(29-7(3)24)9(21-14(25)32-33-15(21)26)12(30-8)31-13(20)16(17,18)19/h8-12,20H,4H2,1-3H3/b20-13+/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | KIAJSIUGIHHCRB-TWMGZHLFSA-N |
| XLogP | 1.39 |
| TPSA | 160.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.81 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|