C32H37F2NO6 — CID 10008181
2-[2-[4-[2-[(2,4-difluorophenyl)methyl-heptylamino]-2-oxoethoxy]-3-methoxyphenyl]ethoxy]benzoic acid (PubChem CID 10008181) has the molecular formula C32H37F2NO6 and a molecular weight of 569.65 g/mol. Its IUPAC name is 2-[2-[4-[2-[(2,4-difluorophenyl)methyl-heptylamino]-2-oxoethoxy]-3-methoxyphenyl]ethoxy]benzoic acid.
| Compound Name | 2-[2-[4-[2-[(2,4-difluorophenyl)methyl-heptylamino]-2-oxoethoxy]-3-methoxyphenyl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 10008181 |
| Molecular Formula | C32H37F2NO6 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 2-[2-[4-[2-[(2,4-difluorophenyl)methyl-heptylamino]-2-oxoethoxy]-3-methoxyphenyl]ethoxy]benzoic acid |
| SMILES | CCCCCCCN(Cc1ccc(F)cc1F)C(=O)COc1ccc(CCOc2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C32H37F2NO6/c1-3-4-5-6-9-17-35(21-24-13-14-25(33)20-27(24)34)31(36)22-41-29-15-12-23(19-30(29)39-2)16-18-40-28-11-8-7-10-26(28)32(37)38/h7-8,10-15,19-20H,3-6,9,16-18,21-22H2,1-2H3,(H,37,38) |
| InChIKey | LQSIRDWBCRAUES-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|