C31H36ClNO4 — CID 10436753
2-[[4-[2-[2-(4-chlorophenyl)ethyl-heptylamino]-2-oxoethyl]phenyl]methoxy]benzoic acid (PubChem CID 10436753) has the molecular formula C31H36ClNO4 and a molecular weight of 522.09 g/mol. Its IUPAC name is 2-[[4-[2-[2-(4-chlorophenyl)ethyl-heptylamino]-2-oxoethyl]phenyl]methoxy]benzoic acid.
| Compound Name | 2-[[4-[2-[2-(4-chlorophenyl)ethyl-heptylamino]-2-oxoethyl]phenyl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 10436753 |
| Molecular Formula | C31H36ClNO4 |
| Molecular Weight | 522.09 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 2-[[4-[2-[2-(4-chlorophenyl)ethyl-heptylamino]-2-oxoethyl]phenyl]methoxy]benzoic acid |
| SMILES | CCCCCCCN(CCc1ccc(Cl)cc1)C(=O)Cc1ccc(COc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H36ClNO4/c1-2-3-4-5-8-20-33(21-19-24-15-17-27(32)18-16-24)30(34)22-25-11-13-26(14-12-25)23-37-29-10-7-6-9-28(29)31(35)36/h6-7,9-18H,2-5,8,19-23H2,1H3,(H,35,36) |
| InChIKey | RLELFOUVBVIHBC-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.09 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|