C30H40N4O6S — CID 10008480
(2R)-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-[(1S,3S)-3-[(4-nitrophenyl)sulfonylamino]cyclopentyl]-2-phenylacetamide (PubChem CID 10008480) has the molecular formula C30H40N4O6S and a molecular weight of 584.74 g/mol. Its IUPAC name is (2R)-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-[(1S,3S)-3-[(4-nitrophenyl)sulfonylamino]cyclopentyl]-2-phenylacetamide.
| Compound Name | (2R)-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-[(1S,3S)-3-[(4-nitrophenyl)sulfonylamino]cyclopentyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 10008480 |
| Molecular Formula | C30H40N4O6S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | (2R)-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-[(1S,3S)-3-[(4-nitrophenyl)sulfonylamino]cyclopentyl]-2-phenylacetamide |
| SMILES | CC(C)=CCCN1CCC(NC(=O)[C@](O)(c2ccccc2)[C@H]2CC[C@H](NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)C2)CC1 |
| InChI | InChI=1S/C30H40N4O6S/c1-22(2)7-6-18-33-19-16-25(17-20-33)31-29(35)30(36,23-8-4-3-5-9-23)24-10-11-26(21-24)32-41(39,40)28-14-12-27(13-15-28)34(37)38/h3-5,7-9,12-15,24-26,32,36H,6,10-11,16-21H2,1-2H3,(H,31,35)/t24-,26-,30-/m0/s1 |
| InChIKey | SHWBBZFKHUHMPQ-QECWJDIYSA-N |
| XLogP | 3.87 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|