C23H34N2O4 — CID 23289906
tert-butyl 4-[(2-cyclopentyl-2-hydroxy-2-phenylacetyl)amino]piperidine-1-carboxylate (PubChem CID 23289906) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl 4-[(2-cyclopentyl-2-hydroxy-2-phenylacetyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-cyclopentyl-2-hydroxy-2-phenylacetyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23289906 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | tert-butyl 4-[(2-cyclopentyl-2-hydroxy-2-phenylacetyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C23H34N2O4/c1-22(2,3)29-21(27)25-15-13-19(14-16-25)24-20(26)23(28,18-11-7-8-12-18)17-9-5-4-6-10-17/h4-6,9-10,18-19,28H,7-8,11-16H2,1-3H3,(H,24,26) |
| InChIKey | DJWXHCBAWXNQTC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |