C26H31N3O5S — CID 67537484
3-(2-methylimidazol-1-yl)propyl (2R)-2-[(1S)-3-(benzenesulfonamido)cyclopentyl]-2-hydroxy-2-phenylacetate (PubChem CID 67537484) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is 3-(2-methylimidazol-1-yl)propyl (2R)-2-[(1S)-3-(benzenesulfonamido)cyclopentyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 3-(2-methylimidazol-1-yl)propyl (2R)-2-[(1S)-3-(benzenesulfonamido)cyclopentyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 67537484 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 3-(2-methylimidazol-1-yl)propyl (2R)-2-[(1S)-3-(benzenesulfonamido)cyclopentyl]-2-hydroxy-2-phenylacetate |
| SMILES | Cc1nccn1CCCOC(=O)[C@](O)(c1ccccc1)[C@H]1CCC(NS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C26H31N3O5S/c1-20-27-15-17-29(20)16-8-18-34-25(30)26(31,21-9-4-2-5-10-21)22-13-14-23(19-22)28-35(32,33)24-11-6-3-7-12-24/h2-7,9-12,15,17,22-23,28,31H,8,13-14,16,18-19H2,1H3/t22-,23?,26-/m0/s1 |
| InChIKey | XDGJUIFLNFPOGP-XTHODOOASA-N |
| XLogP | 3.16 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|