About 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one
2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 10012513) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
Analyze 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The IUPAC name of 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (CID 10012513) is 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
What is the SMILES notation for 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The canonical SMILES for 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one is CC1OC2(C=CC(=O)C=C2)OC1C.
What is the InChIKey of 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The InChIKey is PKEIDHDAQJKTAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7-8(2)13-10(12-7)5-3-9(11)4-6-10/h3-8H,1-2H3.
What are the key properties of 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one has a molecular weight of 180.20 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one is sourced from PubChem (CID 10012513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).