methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate

C9H14O4 — CID 10012653

IUPACmethyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate
SMILESCOC(=O)C/C=C1/COC(C)(C)O1
InChIInChI=1S/C9H14O4/c1-9(2)12-6-7(13-9)4-5-8(10)11-3/h4H,5-6H2,1-3H3/b7-4-
InChIKeyQUZNIJVALVQHCV-DAXSKMNVSA-N
MW186.21 g/mol
LogP1.22
Rot. Bonds2

About methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate

methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate (PubChem CID 10012653) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate.

Molecular Properties

Compound Namemethyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate
PubChem CID10012653
Molecular FormulaC9H14O4
Molecular Weight186.21 g/mol
Exact Mass186.09
IUPAC Namemethyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate
SMILESCOC(=O)C/C=C1/COC(C)(C)O1
InChIInChI=1S/C9H14O4/c1-9(2)12-6-7(13-9)4-5-8(10)11-3/h4H,5-6H2,1-3H3/b7-4-
InChIKeyQUZNIJVALVQHCV-DAXSKMNVSA-N
XLogP1.22
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.21
LogP ≤ 51.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate?
The IUPAC name of methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate (CID 10012653) is methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate.
What is the SMILES notation for methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate?
The canonical SMILES for methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate is COC(=O)C/C=C1/COC(C)(C)O1.
What is the InChIKey of methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate?
The InChIKey is QUZNIJVALVQHCV-DAXSKMNVSA-N. The full InChI is InChI=1S/C9H14O4/c1-9(2)12-6-7(13-9)4-5-8(10)11-3/h4H,5-6H2,1-3H3/b7-4-.
What are the key properties of methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate?
methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate has a molecular weight of 186.21 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3Z)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)propanoate is sourced from PubChem (CID 10012653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).