C10H15N3O — CID 10012832
5-[(E)-4-(methylamino)pent-1-enyl]-1H-pyrimidin-6-one (PubChem CID 10012832) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-[(E)-4-(methylamino)pent-1-enyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[(E)-4-(methylamino)pent-1-enyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 10012832 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 5-[(E)-4-(methylamino)pent-1-enyl]-1H-pyrimidin-6-one |
| SMILES | CNC(C)C/C=C/c1cnc[nH]c1=O |
| InChI | InChI=1S/C10H15N3O/c1-8(11-2)4-3-5-9-6-12-7-13-10(9)14/h3,5-8,11H,4H2,1-2H3,(H,12,13,14)/b5-3+ |
| InChIKey | BXDOQSYLYHHEHO-HWKANZROSA-N |
| XLogP | 0.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |