C11H12N2O — CID 137176641
4-ethenyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-1H-pyrimidin-6-one (PubChem CID 137176641) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-ethenyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethenyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137176641 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-ethenyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-1H-pyrimidin-6-one |
| SMILES | C=C/C(C)=C\c1c(C=C)nc[nH]c1=O |
| InChI | InChI=1S/C11H12N2O/c1-4-8(3)6-9-10(5-2)12-7-13-11(9)14/h4-7H,1-2H2,3H3,(H,12,13,14)/b8-6- |
| InChIKey | SRVWLAGZCWSHFQ-VURMDHGXSA-N |
| XLogP | 2.00 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|